CAS 1638767-58-4: Methyl 5-amino-1H-indole-6-carboxylate

Description:Methyl 5-amino-1H-indole-6-carboxylate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features an amino group (-NH2) and a carboxylate group (-COOCH3) attached to the indole framework, contributing to its potential biological activity. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions and applications. Methyl 5-amino-1H-indole-6-carboxylate may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, particularly due to the indole moiety, which is known for its role in many biologically active compounds. Additionally, the compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula:C₁₀H₁₀N₂O₂

InChI:InChI=1S/C10H10N2O2/c1-14-10(13)7-5-9-6(2-3-12-9)4-8(7)11/h2-5,12H,11H2,1H3

InChI key:InChIKey=BUEHYNPNQVZAJA-UHFFFAOYSA-N

SMILES:O=C(OC)C1=CC=2NC=CC2C=C1N

Synonyms:
1H-Indole-6-carboxylic acid, 5-amino-, methyl ester
Methyl 5-amino-1H-indole-6-carboxylate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Methyl5-amino-1h-indole-6-carboxylate REF: 10-F719118CAS: 1638767-58-4	97%	21.00 €~166.00 €	Tue 08 Apr 25
methyl 5-amino-1H-indole-6-carboxylate REF: IN-DA01JV49CAS: 1638767-58-4	98%	To inquire	Tue 15 Apr 25
Methyl5-amino-1h-indole-6-carboxylate REF: 54-OR81433CAS: 1638767-58-4	95%	96.00 €~363.00 €	Wed 16 Apr 25
Methyl 5-amino-1H-indole-6-carboxylate REF: 3D-NQC76758CAS: 1638767-58-4	Min. 95%	- - -	Discontinued product