CAS 1638767-63-1

1,1-Dimethylethyl 3-ethyl-3-ethynyl-1-azetidinecarboxylate

Description:

1,1-Dimethylethyl 3-ethyl-3-ethynyl-1-azetidinecarboxylate is a chemical compound characterized by its unique structure, which includes an azetidine ring—a four-membered nitrogen-containing heterocycle. This compound features a tert-butyl group (1,1-dimethylethyl) and an ethynyl substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, including esterification and nucleophilic substitutions. Its molecular structure suggests that it may exhibit interesting properties such as solubility in organic solvents and potential biological activity, making it a candidate for further research in medicinal chemistry or materials science. The compound's CAS number, 1638767-63-1, allows for easy identification in chemical databases, facilitating its study and application in various fields. Overall, the characteristics of this compound highlight its significance in synthetic chemistry and potential utility in developing new chemical entities.

Formula: C₁₂H₁₉NO₂

InChI: InChI=1S/C12H19NO2/c1-6-12(7-2)8-13(9-12)10(14)15-11(3,4)5/h1H,7-9H2,2-5H3

InChI key: InChIKey=NICSIHBXMSGFFK-UHFFFAOYSA-N

SMILES: C(C)C1(C#C)CN(C(OC(C)(C)C)=O)C1

Synonyms:

• 1-Azetidinecarboxylic acid, 3-ethyl-3-ethynyl-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-ethyl-3-ethynyl-1-azetidinecarboxylate

tert-Butyl 3-ethyl-3-ethynylazetidine-1-carboxylate

CAS: 1638767-63-1

Versatile small molecule scaffold

Formula: C₁₂H₁₉NO₂

Purity: Min. 95%

Molecular weight: 209.28 g/mol

Ref: 3D-NQC76763