CAS 1638767-79-9
:1,1-Dimethylethyl N-[(3-formylbicyclo[1.1.1]pent-1-yl)methyl]carbamate
Description:
1,1-Dimethylethyl N-[(3-formylbicyclo[1.1.1]pent-1-yl)methyl]carbamate, identified by its CAS number 1638767-79-9, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) adjacent to a nitrogen atom (N). This compound contains a bicyclic structure, specifically a bicyclo[1.1.1]pentane moiety, which contributes to its unique three-dimensional shape and potential reactivity. The presence of the formyl group indicates that it has an aldehyde functional group, which can participate in various chemical reactions, such as condensation or oxidation. The dimethyl substituents on the nitrogen suggest steric hindrance, which may influence the compound's reactivity and interactions with other molecules. Overall, this compound may exhibit interesting properties and applications in organic synthesis or medicinal chemistry, although specific characteristics such as solubility, melting point, and stability would require empirical data for a comprehensive understanding.
Formula:C12H19NO3
InChI:InChI=1S/C12H19NO3/c1-10(2,3)16-9(15)13-7-11-4-12(5-11,6-11)8-14/h8H,4-7H2,1-3H3,(H,13,15)
InChI key:InChIKey=IZFLQRGYSHPHTC-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C12CC(C=O)(C1)C2
Synonyms:- Carbamic acid, N-[(3-formylbicyclo[1.1.1]pent-1-yl)methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[(3-formylbicyclo[1.1.1]pent-1-yl)methyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl ((3-formylbicyclo[1.1.1]pentan-1-yl)methyl)carbamate
CAS:tert-Butyl ((3-formylbicyclo[1.1.1]pentan-1-yl)methyl)carbamate
Molecular weight:225.28g/mol
