CAS 1638768-11-2

α,α,6-Trifluoro-2-methyl-2H-indazole-5-acetic acid

Description:

α,α,6-Trifluoro-2-methyl-2H-indazole-5-acetic acid is a chemical compound characterized by its unique indazole structure, which includes a trifluoromethyl group and a carboxylic acid functional group. This compound features a trifluoro substitution at the 6-position of the indazole ring, contributing to its distinct chemical properties, such as increased lipophilicity and potential biological activity. The presence of the methyl group at the 2-position further influences its reactivity and solubility. As an acetic acid derivative, it exhibits acidic properties, which can affect its interactions in biological systems and its potential as a pharmaceutical agent. The trifluoromethyl group is known to enhance metabolic stability and bioactivity, making this compound of interest in medicinal chemistry. Its specific applications may vary, but it is often explored for its potential in drug development and as a research tool in various biochemical studies. Overall, this compound exemplifies the importance of fluorinated compounds in modern chemistry and their role in enhancing the properties of organic molecules.

Formula: C₁₀H₇F₃N₂O₂

InChI: InChI=1S/C10H7F3N2O2/c1-15-4-5-2-6(10(12,13)9(16)17)7(11)3-8(5)14-15/h2-4H,1H3,(H,16,17)

InChI key: InChIKey=MKGLUHJPEIAJGD-UHFFFAOYSA-N

SMILES: C(C(O)=O)(F)(F)C1=CC=2C(C=C1F)=NN(C)C2

Synonyms:

• 2H-Indazole-5-acetic acid, α,α,6-trifluoro-2-methyl-
• α,α,6-Trifluoro-2-methyl-2H-indazole-5-acetic acid