CAS 1638769-07-9

Methyl 1H-pyrazolo[3,4-b]pyridine-4-carboxylate

Description:

Methyl 1H-pyrazolo[3,4-b]pyridine-4-carboxylate is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a carboxylate functional group, which contributes to its reactivity and potential applications in medicinal chemistry. It is typically a crystalline solid at room temperature and exhibits moderate solubility in polar organic solvents. The presence of the methyl ester group enhances its lipophilicity, making it suitable for various biological applications. Methyl 1H-pyrazolo[3,4-b]pyridine-4-carboxylate is of interest in pharmaceutical research due to its potential as a scaffold for developing novel therapeutic agents, particularly in the context of targeting specific biological pathways. Its unique structural features may also confer specific pharmacological properties, making it a candidate for further investigation in drug discovery programs. As with many heterocycles, the compound's stability and reactivity can be influenced by substituents on the rings, which can be tailored for desired interactions in biological systems.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-13-8(12)5-2-3-9-7-6(5)4-10-11-7/h2-4H,1H3,(H,9,10,11)

InChI key: InChIKey=VNALUAYRSSZMJO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=NC=C1)NN=C2

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, methyl ester
• Methyl 1H-pyrazolo[3,4-b]pyridine-4-carboxylate

Methyl 1H-pyrazolo[3,4-b]pyridine-4-carboxylate

CAS: 1638769-07-9

Formula: C₈H₇N₃O₂

Molecular weight: 177.1601

Ref: IN-DA01EE2Q

Methyl 1H-pyrazolo[3,4-b]pyridine-4-carboxylate-hydrochloride

Controlled Product

CAS: 1638769-07-9

Formula: C₈H₇N₃O₂·x(HCl)

Color and Shape: Neat

Molecular weight: 213.62

Ref: TR-M393020

Methyl 1H-pyrazolo[3,4-b]pyridine-4-carboxylate

CAS: 1638769-07-9

Versatile small molecule scaffold

Formula: C₈H₇N₃O₂

Purity: Min. 95%

Molecular weight: 177.16 g/mol

Ref: 3D-NQC76907