CAS 1638771-32-0

1,1-Dimethylethyl N-(8-oxobicyclo[3.2.1]oct-3-yl)carbamate

Description:

1,1-Dimethylethyl N-(8-oxobicyclo[3.2.1]oct-3-yl)carbamate, identified by its CAS number 1638771-32-0, is a chemical compound that features a bicyclic structure, which contributes to its unique properties. The presence of the 8-oxo group indicates that it has a ketone functionality, which can influence its reactivity and stability. The dimethyl group attached to the nitrogen atom suggests steric hindrance, potentially affecting its interaction with other molecules. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its carbamate functional group can participate in hydrogen bonding and may enhance solubility in polar solvents. Additionally, the bicyclic framework may impart rigidity, influencing the compound's conformational dynamics. Overall, the characteristics of this compound suggest potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activity and practical applications would require further investigation and characterization.

Formula: C₁₃H₂₁NO₃

InChI: InChI=1S/C13H21NO3/c1-13(2,3)17-12(16)14-10-6-8-4-5-9(7-10)11(8)15/h8-10H,4-7H2,1-3H3,(H,14,16)

InChI key: InChIKey=HLYGBCMBJPUFGL-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1CC2C(=O)C(C1)CC2

Synonyms:

• 1,1-Dimethylethyl N-(8-oxobicyclo[3.2.1]oct-3-yl)carbamate
• Carbamic acid, N-(8-oxobicyclo[3.2.1]oct-3-yl)-, 1,1-dimethylethyl ester

tert-Butyl (8-oxobicyclo[3.2.1]octan-3-yl)carbamate

CAS: 1638771-32-0

Versatile small molecule scaffold

Formula: C₁₃H₂₁NO₃

Purity: Min. 95%

Molecular weight: 239.31 g/mol

Ref: 3D-NQC77132