CymitQuimica logo

CAS 1638771-34-2

:

1,1-Dimethylethyl 4-(hydroxymethyl)-2,2-dimethyl-1-azetidinecarboxylate

Description:
1,1-Dimethylethyl 4-(hydroxymethyl)-2,2-dimethyl-1-azetidinecarboxylate, identified by its CAS number 1638771-34-2, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of hydroxymethyl and dimethyl groups indicates that it may exhibit unique steric and electronic properties, influencing its interactions in chemical reactions. The bulky tert-butyl group (1,1-dimethylethyl) can provide steric hindrance, potentially affecting the compound's reactivity and stability. Such characteristics suggest that it may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's structural features may allow for specific interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Overall, its unique structure and functional groups position it as a compound of interest for various chemical applications.
Formula:C11H21NO3
InChI:InChI=1S/C11H21NO3/c1-10(2,3)15-9(14)12-8(7-13)6-11(12,4)5/h8,13H,6-7H2,1-5H3
InChI key:InChIKey=XTSDZFSFUUQOCF-UHFFFAOYSA-N
SMILES:C(O)C1N(C(OC(C)(C)C)=O)C(C)(C)C1
Synonyms:
  • 1,1-Dimethylethyl 4-(hydroxymethyl)-2,2-dimethyl-1-azetidinecarboxylate
  • 1-Azetidinecarboxylic acid, 4-(hydroxymethyl)-2,2-dimethyl-, 1,1-dimethylethyl ester
  • tert-Butyl 4-(hydroxymethyl)-2,2-dimethylazetidine-1-carboxylate
Found 3 products.