CAS 1638771-46-6

1,1-Dimethylethyl 6-(iodomethyl)-5-oxa-2-azaspiro[3.4]octane-2-carboxylate

Description:

1,1-Dimethylethyl 6-(iodomethyl)-5-oxa-2-azaspiro[3.4]octane-2-carboxylate, identified by its CAS number 1638771-46-6, is a chemical compound characterized by its complex spirocyclic structure, which includes both an azaspiro framework and an ester functional group. The presence of the iodomethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The compound features a five-membered oxygen-containing ring, contributing to its unique chemical properties and potential applications in medicinal chemistry. Its dimethyl substituents enhance steric hindrance, which may influence its reactivity and interaction with biological targets. The carboxylate moiety indicates that it can participate in various chemical reactions, including esterification and acid-base reactions. Overall, this compound's structural features suggest it may have interesting pharmacological properties, making it a candidate for further research in drug development and synthetic chemistry. However, specific details regarding its biological activity, solubility, and stability would require empirical investigation.

Formula: C₁₂H₂₀INO₃

InChI: InChI=1S/C12H20INO3/c1-11(2,3)17-10(15)14-7-12(8-14)5-4-9(6-13)16-12/h9H,4-8H2,1-3H3

InChI key: InChIKey=LYGQZEWJUKSMPU-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(C1)OC(CI)CC2

Synonyms:

• 1,1-Dimethylethyl 6-(iodomethyl)-5-oxa-2-azaspiro[3.4]octane-2-carboxylate
• 5-Oxa-2-azaspiro[3.4]octane-2-carboxylic acid, 6-(iodomethyl)-, 1,1-dimethylethyl ester

tert-Butyl 6-(iodomethyl)-5-oxa-2-azaspiro[3.4]octane-2-carboxylate

CAS: 1638771-46-6

Versatile small molecule scaffold

Formula: C₁₂H₂₀INO₃

Purity: Min. 95%

Molecular weight: 353.2 g/mol

Ref: 3D-NQC77146