CymitQuimica logo

CAS 1638771-47-7

:

4,6-Dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine

Description:
4,6-Dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of two chlorine atoms at the 4 and 6 positions and a methyl group at the 3 position enhances its reactivity and solubility in various solvents. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is of interest in medicinal chemistry and may have potential applications in drug development due to its structural features that can interact with biological targets. The compound's molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 4,6-Dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine is a significant compound in research contexts, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C8H6Cl2N2
InChI:InChI=1S/C8H6Cl2N2/c1-4-3-11-8-7(4)5(9)2-6(10)12-8/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=XTQKFSGVCGUOTN-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(Cl)=C1)NC=C2C
Synonyms:
  • 4,6-Dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 4,6-dichloro-3-methyl-
Found 3 products.