
CAS 1638771-50-2
:1H-Pyrrolo[2,3-b]pyridine-2-methanamine, hydrochloride (1:2)
Description:
1H-Pyrrolo[2,3-b]pyridine-2-methanamine, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for various applications in medicinal chemistry and drug development. The presence of the methanamine group contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit biological activity, which is of interest in pharmacological research, particularly in the development of new therapeutic agents. Its specific interactions and mechanisms of action would require further investigation through experimental studies. Overall, 1H-Pyrrolo[2,3-b]pyridine-2-methanamine, hydrochloride is a compound of interest in the field of organic and medicinal chemistry.
Formula:C8H9N3·2ClH
InChI:InChI=1S/C8H9N3.2ClH/c9-5-7-4-6-2-1-3-10-8(6)11-7;;/h1-4H,5,9H2,(H,10,11);2*1H
InChI key:InChIKey=OAEHGGHGKDENFR-UHFFFAOYSA-N
SMILES:C(N)C1=CC=2C(N1)=NC=CC2.Cl
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-2-methanamine, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.