CymitQuimica logo

CAS 1638772-11-8

:

2-Chloro-5,7-dihydro-5,5-dimethyl-6H-pyrrolo[2,3-d]pyrimidin-6-one

Description:
2-Chloro-5,7-dihydro-5,5-dimethyl-6H-pyrrolo[2,3-d]pyrimidin-6-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of a chlorine atom at the second position and two methyl groups at the fifth position contribute to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, due to the presence of reactive functional groups. Additionally, its stability and reactivity can be influenced by the electronic effects of the chlorine and methyl substituents. Overall, 2-Chloro-5,7-dihydro-5,5-dimethyl-6H-pyrrolo[2,3-d]pyrimidin-6-one represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, pending further research into its biological activity and synthesis.
Formula:C8H8ClN3O
InChI:InChI=1S/C8H8ClN3O/c1-8(2)4-3-10-7(9)12-5(4)11-6(8)13/h3H,1-2H3,(H,10,11,12,13)
InChI key:InChIKey=ANLSHVHLNFEOSB-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(NC1=O)=NC(Cl)=NC2
Synonyms:
  • 2-Chloro-5,7-dihydro-5,5-dimethyl-6H-pyrrolo[2,3-d]pyrimidin-6-one
  • 6H-Pyrrolo[2,3-d]pyrimidin-6-one, 2-chloro-5,7-dihydro-5,5-dimethyl-
Found 3 products.