
CAS 1638772-17-4
:3-Methylenebicyclo[3.2.1]octan-8-ol
Description:
3-Methylenebicyclo[3.2.1]octan-8-ol is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a bicyclo[3.2.1] framework with a methylene bridge and a hydroxyl (-OH) group at the 8-position. This compound features a combination of saturated and unsaturated carbon atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxyl group indicates that it can participate in hydrogen bonding, influencing its solubility and boiling point. Additionally, the methylene group introduces a degree of unsaturation, which may affect its stability and reactivity towards electrophiles or nucleophiles. The compound's stereochemistry can also play a significant role in its biological activity and interactions with other molecules. Overall, 3-Methylenebicyclo[3.2.1]octan-8-ol is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential functional properties.
Formula:C9H14O
InChI:InChI=1S/C9H14O/c1-6-4-7-2-3-8(5-6)9(7)10/h7-10H,1-5H2
InChI key:InChIKey=WICLFDAYFFGISB-UHFFFAOYSA-N
SMILES:OC1C2CC(=C)CC1CC2
Synonyms:- Bicyclo[3.2.1]octan-8-ol, 3-methylene-
- 3-Methylidenebicyclo[3.2.1]octan-8-ol
- 3-Methylenebicyclo[3.2.1]octan-8-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.