CAS 1639-04-9

2-methylpentane-3-thiol

Description:

2-Methylpentane-3-thiol, with the CAS number 1639-04-9, is an organic compound classified as a thiol, which is characterized by the presence of a sulfhydryl group (-SH). This compound features a five-carbon chain with a methyl group attached to the second carbon and a thiol group on the third carbon, giving it a distinctive structure. It is typically a colorless to pale yellow liquid with a strong, unpleasant odor reminiscent of garlic or rotten cabbage, which is common among thiols. 2-Methylpentane-3-thiol is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon chain. It is used in various applications, including as a flavoring agent and in the synthesis of other chemical compounds. The compound's reactivity is influenced by the thiol group, allowing it to participate in various chemical reactions, such as oxidation to form disulfides. Safety precautions are necessary when handling this substance due to its strong odor and potential irritant properties.

Formula: C₆H₁₄S

InChI: InChI=1/C6H14S/c1-4-6(7)5(2)3/h5-7H,4H2,1-3H3

SMILES: CCC(C(C)C)S

Synonyms:

• 1-Ethyl-2-methylpropyl hydrosulfide
• 3-Pentanethiol, 2-Methyl-
• 2-Methylpentane-3-thiol
• 2-Methyl-3-pentanethiol