
CAS 1639208-51-7
:L-Valine, (2R,3R,11bR)-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-yl ester, hydrochloride (1:2)
Description:
L-Valine, with the specified chemical structure and CAS number 1639208-51-7, is a derivative of the amino acid valine, which is one of the essential branched-chain amino acids. This compound features a complex bicyclic structure, characterized by a hexahydrobenzoquinolizine framework, and includes methoxy groups and an ester functional group. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its bioavailability. The presence of the 2-methylpropyl group suggests potential hydrophobic interactions, influencing its pharmacological properties. L-Valine is known for its role in protein synthesis and is involved in various metabolic processes. Its specific stereochemistry, indicated by the (2R,3R,11bR) notation, suggests that it may exhibit unique biological activity or binding characteristics. Overall, this compound may have applications in pharmaceuticals or biochemistry, particularly in studies related to amino acid metabolism or as a potential therapeutic agent.
Formula:C24H38N2O4·2ClH
InChI:InChI=1S/C24H38N2O4.2ClH/c1-14(2)9-17-13-26-8-7-16-10-21(28-5)22(29-6)11-18(16)19(26)12-20(17)30-24(27)23(25)15(3)4;;/h10-11,14-15,17,19-20,23H,7-9,12-13,25H2,1-6H3;2*1H/t17-,19-,20-,23+;;/m1../s1
InChI key:InChIKey=PMSGGBFTMLDQAW-TZYFFPFWSA-N
SMILES:O(C([C@H](C(C)C)N)=O)[C@@H]1C[C@@]2(C=3C(=CC(OC)=C(OC)C3)CCN2C[C@H]1CC(C)C)[H].Cl
Synonyms:- Valbenazine dihydrochloride
- L-Valine, (2R,3R,11bR)-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-yl ester, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Valbenazine dihydrochloride
CAS:<p>Valbenazine dihydrochloride inhibits vesicular monoamine transporter 2 (VMAT2); used to treat tardive dyskinesia.</p>Formula:C24H40Cl2N2O4Color and Shape:SolidMolecular weight:491.49
