CAS 163931-61-1
:Tetrabutylammonium triphenyldifluorosilicate (TBAT)
Description:
Tetrabutylammonium triphenyldifluorosilicate (TBAT) is an organosilicon compound characterized by its unique structure, which includes a tetrabutylammonium cation and a triphenyldifluorosilicate anion. This compound is typically a white to light yellow solid at room temperature and is soluble in organic solvents, making it useful in various applications, particularly in organic synthesis and as a phase transfer catalyst. TBAT exhibits stability under standard conditions, although it may decompose upon exposure to moisture or high temperatures. The presence of fluorine atoms in the silicate anion contributes to its unique chemical properties, including enhanced reactivity and potential applications in materials science. Additionally, TBAT can facilitate the transfer of silicate species in reactions, making it valuable in the synthesis of silicate-based materials. Safety precautions should be taken when handling TBAT, as with many organosilicon compounds, due to potential toxicity and environmental concerns. Overall, TBAT is a versatile compound with significant implications in both industrial and research settings.
Formula:C34H51F2NSi
InChI:InChI=1/C18H15F2Si.C16H36N/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h1-15H;5-16H2,1-4H3/q-1;+1
SMILES:c1ccc(cc1)[Si-](c1ccccc1)(c1ccccc1)(F)F.CCCCN(CCCC)(CCCC)CCCC
Synonyms:- Tetrabutylammonium triphenyldifluorosilicate
- Tbat
- Tetrabutylammonium difluorotriphenylsilicate
- N,N,N-tributylbutan-1-aminium difluoro(triphenyl)silicate(1-)
- Tetrabutylamoniumdifluorotriphenylsilicate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tetrabutylammonium Difluorotriphenylsilicate
CAS:Formula:C34H51F2NSiPurity:>97.0%(T)(qNMR)Color and Shape:White to Almost white powder to crystalMolecular weight:539.87Tetrabutylammonium difluorotriphenylsilicate
CAS:<p>Tetrabutylammonium difluorotriphenylsilicate</p>Purity:98%Molecular weight:539.86g/molTetrabutylammonium Difluorotriphenylsilicate
CAS:Controlled Product<p>Stability Moisture Sensitive<br>Applications Tetrabutylammonium Difluorotriphenylsilicate is used as a reagent in the synthesis of (S)-N-(3-(3,6-dibromo-9H-carbazol-9-yl)-2-fluoropropyl)-6-methoxypyridin-2-amine ((-)-P7C3-S243); a neuroprotective chemical with improved druglike properties.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Naidoo, J., et al.: J. Med. Chem., 57, 3754 (2014)<br></p>Formula:C18H15F2Si·C16H36NColor and Shape:NeatMolecular weight:539.858Tetrabutylammonium difluorotriphenylsilicate
CAS:<p>Tetrabutylammonium difluorotriphenylsilicate is a model system for studying the mechanism of nucleophilic substitution at an unsymmetrical carbon center. It is used in analytical chemistry to prepare samples for analysis. Tetrabutylammonium difluorotriphenylsilicate has been shown to be an effective and selective reagent for the synthesis of picolinic acid, which can be used as a precursor for the synthesis of nicotinamide riboside, a vitamin B3 derivative. The reaction proceeds via an SN2 mechanism, where hydrogen fluoride (HF) acts as a nucleophile that attacks the electrophilic carbon center of allyl chloride (CH2=CH-CH2Cl) to form an intermediate with two alkyl groups on opposite sides. The reaction product is then hydrolyzed to release tetrabutylammonium chloride (tBuNH4Cl).</p>Formula:C34H51F2NSiPurity:Min. 95%Color and Shape:White PowderMolecular weight:539.86 g/mol




