
CAS 1639897-03-2
:5-(2-Fluorophenyl)-3-methylisoxazole
Description:
5-(2-Fluorophenyl)-3-methylisoxazole is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, contributing to the compound's unique electronic properties and potential reactivity. The methyl group at the 3-position of the isoxazole ring adds to the compound's steric and electronic characteristics. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, influencing the compound's pharmacokinetics. Overall, 5-(2-Fluorophenyl)-3-methylisoxazole represents a class of compounds that may have applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H8FNO
InChI:InChI=1S/C10H8FNO/c1-7-6-10(13-12-7)8-4-2-3-5-9(8)11/h2-6H,1H3
InChI key:InChIKey=ONHXDCUUNSJFMR-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1)C2=CC(C)=NO2
Synonyms:- 5-(2-Fluorophenyl)-3-methylisoxazole
- Isoxazole, 5-(2-fluorophenyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.