CAS 16399-10-3

2-ETHYLAMINO-4-METHOXY-6-METHYL-1,3,5-TRIAZINE

Description:

2-Ethylamino-4-methoxy-6-methyl-1,3,5-triazine is an organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features an ethylamino group, a methoxy group, and a methyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the methoxy and amino functional groups. The presence of nitrogen in the triazine ring can impart basicity and potential reactivity, making it of interest in various chemical applications, including as a potential herbicide or in the synthesis of other organic compounds. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its behavior in biological systems. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₁₂N₄O

InChI: InChI=1/C7H12N4O/c1-4-8-6-9-5(2)10-7(11-6)12-3/h4H2,1-3H3,(H,8,9,10,11)

Synonyms:

• 2-Ethylamino-4-methoxy-6-methyl-1,3,5-triazine
• N-ethyl-4-methoxy-6-methyl-1,3,5-triazin-2-amine