CAS 16407-55-9

Allylbenzoathiazoliumbromide; 98%

Description:

Allylbenzoathiazolium bromide, with the CAS number 16407-55-9, is a chemical compound that belongs to the class of quaternary ammonium salts. It is characterized by its structure, which includes a benzoathiazole moiety and an allyl group, contributing to its unique chemical properties. This compound typically appears as a solid, often in crystalline form, and is soluble in polar solvents. It is known for its applications in various fields, including organic synthesis and as a reagent in chemical reactions. The presence of the bromide ion suggests that it may exhibit ionic characteristics, influencing its reactivity and interactions with other substances. Additionally, due to its quaternary ammonium nature, it may possess antimicrobial properties, making it of interest in biochemistry and pharmacology. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.

Formula: C₁₀H₁₀BrNS

InChI: InChI=1/C10H10NS.BrH/c1-2-7-11-8-12-10-6-4-3-5-9(10)11;/h2-6,8H,1,7H2;1H/q+1;/p-1

Synonyms:

• N-Allylbenzoathiazolium bromide
• 3-(Prop-2-En-1-Yl)-1,3-Benzothiazol-3-Ium Bromide

Benzothiazolium, 3-(2-propen-1-yl)-, bromide (1:1)

CAS: 16407-55-9

Formula: C₁₀H₁₀BrNS

Purity: 98%

Molecular weight: 256.1621

Ref: IN-DA001UMG

3-Allylbenzo[d]thiazol-3-ium bromide

CAS: 16407-55-9

Purity: ≥98%(T)

Molecular weight: 256.1600037

Ref: 10-F770644