CAS 164083-84-5
:(3-{[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethyl-1H-indol-5-yl]oxy}propyl)phosphonic acid
Description:
The chemical substance known as (3-{[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethyl-1H-indol-5-yl]oxy}propyl)phosphonic acid, with the CAS number 164083-84-5, is a phosphonic acid derivative characterized by its complex structure that includes an indole moiety, a benzyl group, and an amino-oxoethyl side chain. This compound typically exhibits properties associated with phosphonic acids, such as potential acidity due to the presence of the phosphonic acid functional group, which can donate protons in solution. The indole structure may contribute to its biological activity, possibly influencing interactions with biological targets. Additionally, the presence of the benzyl and ethyl groups may enhance lipophilicity, affecting its solubility and permeability in biological systems. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Overall, the unique combination of functional groups in this molecule suggests a diverse range of chemical reactivity and potential biological activity.
Formula:C22H27N2O5P
InChI:InChI=1/C22H27N2O5P/c1-2-20-19(14-22(23)25)18-13-17(29-11-6-12-30(26,27)28)9-10-21(18)24(20)15-16-7-4-3-5-8-16/h3-5,7-10,13H,2,6,11-12,14-15H2,1H3,(H2,23,25)(H2,26,27,28)
SMILES:CCc1c(CC(=N)O)c2cc(ccc2n1Cc1ccccc1)OCCCP(=O)(O)O
Synonyms:- Phosphonic acid, [3-[[3-(2-amino-2-oxoethyl)-2-ethyl-1-(phenylmethyl)-1H-indol-5-yl]oxy]propyl]-
- (3-{[3-(2-Amino-2-oxoethyl)-1-benzyl-2-ethyl-1H-indol-5-yl]oxy}propyl)phosphonic acid
- [3-[[3-(2-Amino-2-oxoethyl)-2-ethyl-1-(phenylmethyl)-1H-indol-5-yl]oxy]propyl]-phosphonicacid
- (3-{[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethyl-1H-indol-5-yl]oxy}propyl)phosphonic acid (ApexBio)
- LY 311727
- Phosphonic acid, P-[3-[[3-(2-aMino-2-oxoethyl)-2-ethyl-1-(phenylMethyl)-1H-indol-5-yl]oxy]propyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Phosphonic acid, P-[3-[[3-(2-amino-2-oxoethyl)-2-ethyl-1-(phenylmethyl)-1H-indol-5-yl]oxy]propyl]-
CAS:Formula:C22H27N2O5PPurity:99.0%Molecular weight:430.4339(3-((3-(2-Amino-2-oxoethyl)-1-benzyl-2-ethyl-1H-indol-5-yl)oxy)propyl)phosphonic acid
CAS:(3-((3-(2-Amino-2-oxoethyl)-1-benzyl-2-ethyl-1H-indol-5-yl)oxy)propyl)phosphonic acidPurity:99%Molecular weight:430.44g/molLY311727
CAS:Controlled ProductLY311727 is a metalloprotease inhibitor that binds to the active site of secretory phospholipase A2 (sPLA2) and inhibits its activity. It has been shown to be effective in vitro against skin cells and monoclonal antibody-induced inflammation. LY311727 has also been shown to inhibit neuronal death in vitro, as well as chronic exposure to polymerases. LY311727 has also been shown to have anti-inflammatory effects by inhibiting the production of inflammatory cytokines such as tumor necrosis factor-α (TNF-α), interleukin-1β (IL-1β), and interleukin-6 (IL-6). This compound also inhibits chemically induced autoimmune diseases in mice models. The binding affinity for LY311727 is dependent on temperature, with higher temperatures resulting in stronger binding.Formula:C22H27N2O5PPurity:Min. 95%Molecular weight:430.43 g/molLY-311727
CAS:secreted phospholipase A2 (sPLA2) inhibitorFormula:C22H27N2O5PPurity:98%Color and Shape:SolidMolecular weight:430.43





