CAS 1641-40-3
:2-Chloro-1,3,2-benzodioxaphosphole
Description:
2-Chloro-1,3,2-benzodioxaphosphole, with the CAS number 1641-40-3, is a heterocyclic compound that features a unique structure incorporating both phosphorus and oxygen within a benzodioxaphosphole framework. This compound is characterized by its cyclic arrangement, which includes a five-membered ring containing phosphorus and two oxygen atoms, along with a chlorinated aromatic system. The presence of the chlorine atom contributes to its reactivity and potential applications in various chemical reactions. Typically, compounds of this nature exhibit properties such as moderate stability under standard conditions, but they can be sensitive to moisture and air, necessitating careful handling. The benzodioxaphosphole structure is known for its potential use in the development of phosphorous-containing materials, including ligands in coordination chemistry and as intermediates in organic synthesis. Additionally, due to the presence of the phosphorus atom, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and materials science.
Formula:C6H4ClO2P
InChI:InChI=1S/C6H4ClO2P/c7-10-8-5-3-1-2-4-6(5)9-10/h1-4H
InChI key:InChIKey=YUJYEGDMJZHLMY-UHFFFAOYSA-N
SMILES:ClP1OC=2C(O1)=CC=CC2
Synonyms:- 1,2-Phenylene phosphorochloridite
- 1,2-Phenylene phosphorochloridite ((C<sub>6</sub>H<sub>4</sub>O<sub>2</sub>)ClP)
- 1,3,2-Benzodioxaphosphole, 2-chloro-
- 2-Chloro-1,3,2-benzodioxaphospholane
- 2-Chloro-1,3,2-benzodioxaphosphole
- 2-Chloro-2H-1,3,2-benzodioxaphosphole
- 2-Chloro-4,5-benzo-1,3,2-dioxaphospholane
- Catechyl phosphorus chloride
- Chloro(1,2-phenylenedioxy)phosphine
- Cyclic o-phenylene phosphorochloridite
- Phosphorochloridous Acid, 1,2-Phenylene Ester, Ion(1-)
- Phosphorochloridous acid orthophenylene ester
- Phosphorochloridous acid, cyclic o-phenylene ester
- Pyrocatechol phosphoryl chloride
- Pyrocatechol, cyclic phosphorochloridite
- o-Phenylene chlorophosphite
- o-Phenylene phosphorochloridite ((C<sub>6</sub>H<sub>4</sub>O<sub>2</sub>)ClP)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,2-Phenylene phosphorochloridite
CAS:1,2-Phenylene phosphorochloridite is a chemical that is an intermediate for the synthesis of perfluorinated compounds. It has been used as a precursor for the synthesis of biodiesel. The proton NMR spectrum shows three resonances: one at δ 3.8 ppm (J = 6 Hz) corresponding to the protons on the aromatic ring, one at δ 4.7 ppm (J = 6 Hz) corresponding to the protons on the chloro group, and one at δ 7.6 ppm (J = 2 Hz) corresponding to the protons on the methylene chain. This chemical can be prepared by reacting trifluoroacetic acid with phenol in a preparative method with nucleophilic substitution or by dehydrating fatty alcohols with halides in a dehydration reaction.
Formula:C6H4ClO2PPurity:Min. 95%Color and Shape:PowderMolecular weight:174.52 g/mol

