CymitQuimica logo

CAS 1641-61-8

:

DIMETHYL CYCLOHEXYLPHOSPHONATE

Description:
Dimethyl cyclohexylphosphonate, with the CAS number 1641-61-8, is an organophosphorus compound characterized by its phosphonate functional group. It typically appears as a colorless to pale yellow liquid with a distinctive odor. This compound is known for its moderate volatility and solubility in organic solvents, while being less soluble in water. Dimethyl cyclohexylphosphonate is primarily used as an intermediate in the synthesis of various chemicals, including pesticides and pharmaceuticals. Its structure features a cyclohexyl group attached to a phosphorus atom, which is further bonded to two methyl groups, contributing to its unique chemical properties. The compound exhibits low toxicity compared to other organophosphates, but it should still be handled with care due to potential health risks associated with exposure. Additionally, it may undergo hydrolysis in the presence of water, leading to the formation of phosphonic acid derivatives. Overall, dimethyl cyclohexylphosphonate is a versatile compound with applications in chemical synthesis and research.
Formula:C8H17O3P
InChI:InChI=1/C8H17O3P/c1-10-12(9,11-2)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3
SMILES:COP(=O)(C1CCCCC1)OC
Synonyms:
  • Dimethyl Phenylphosphonate
  • Phosphonic acid, phenyl-, dimethyl ester
  • phosphonic acid, P-phenyl-, dimethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.