CAS 1641-63-0
:Pentaphenylphosphole oxide
Description:
Pentaphenylphosphole oxide, with the CAS number 1641-63-0, is an organophosphorus compound characterized by a five-membered phosphole ring that is substituted with five phenyl groups and contains a phosphorus-oxygen double bond. This compound exhibits unique electronic properties due to the presence of the phosphorus atom, which contributes to its reactivity and stability. Pentaphenylphosphole oxide is typically a solid at room temperature and is known for its high thermal stability and resistance to oxidation. It can act as a ligand in coordination chemistry and has potential applications in materials science, particularly in the development of organic semiconductors and phosphorescent materials. The presence of multiple phenyl groups enhances its solubility in organic solvents and contributes to its distinctive optical properties. Additionally, the compound's structure allows for interesting interactions with other chemical species, making it a subject of interest in various research fields, including organic synthesis and catalysis.
Formula:C34H25OP
InChI:InChI=1S/C34H25OP/c35-36(30-24-14-5-15-25-30)33(28-20-10-3-11-21-28)31(26-16-6-1-7-17-26)32(27-18-8-2-9-19-27)34(36)29-22-12-4-13-23-29/h1-25H
InChI key:InChIKey=RUYPYNHPTFDWFA-UHFFFAOYSA-N
SMILES:O=P1(C(=C(C(=C1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6
Synonyms:- Phosphole, pentaphenyl-, 1-oxide
- 1,2,3,4,5-Pentaphenylphosphole oxide
- Pentaphenylphosphole 1-oxide
- 1,2,3,4,5-Pentaphenylphosphole 1-oxide
- 1H-Phosphole, 1,2,3,4,5-pentaphenyl-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
