CAS 16416-31-2

N-OCTADECANE-D38

Description:

N-Octadecane-D38 is a deuterated form of n-octadecane, a straight-chain alkane with the chemical formula C18H38. The "D38" designation indicates that this compound contains deuterium, a stable isotope of hydrogen, which replaces some of the hydrogen atoms in the molecule. This substitution alters the physical properties of the compound, such as its boiling point and density, compared to its non-deuterated counterpart. N-Octadecane-D38 is typically used in scientific research, particularly in studies involving nuclear magnetic resonance (NMR) spectroscopy, where deuterated solvents are preferred to minimize interference from hydrogen signals. The compound is a colorless, odorless liquid at room temperature and is insoluble in water but soluble in organic solvents. Its applications extend to fields such as materials science, organic chemistry, and environmental studies, where it can serve as a standard or reference material. As with other alkanes, it is relatively non-toxic, but standard safety precautions should be observed when handling it in a laboratory setting.

Formula: C₁₈D₃₈

InChI: InChI=1/C18H38/c1-3-5-7-9-11-13-15-17-18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2,17D2,18D2

SMILES: C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]

Synonyms:

• (~2~H_38_)Octadecane
• Octadecane-D_38_

n-Octadecane-d38

CAS: 16416-31-2

Formula: CD₃(CD₂)₁₆CD₃

Purity: 98 atom % D

Color and Shape: White Solid/Colorless Liquid

Molecular weight: 292.53587

Ref: 3U-D0956

n-Octadecane-d38

Controlled Product

CAS: 16416-31-2

Applications n-Octadecane-d38 (CAS# 16416-31-2) is a useful isotopically labeled research compound.

Formula: C₁₈D₃₈

Color and Shape: Neat

Molecular weight: 292.73

Ref: TR-O235106