CymitQuimica logo

CAS 164161-49-3

:

Benzoic acid, 4-methoxy-2-nitro-5-(phenylmethoxy)-, methyl ester

Description:
Benzoic acid, 4-methoxy-2-nitro-5-(phenylmethoxy)-, methyl ester, identified by its CAS number 164161-49-3, is an organic compound characterized by its complex structure, which includes a benzoic acid core modified with methoxy and nitro functional groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. The presence of the methoxy group enhances its solubility in organic solvents, while the nitro group can influence its electronic properties and reactivity. As an ester, it is expected to undergo hydrolysis under acidic or basic conditions, releasing methanol and the corresponding benzoic acid derivative. The compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis and applications could involve various organic reactions, including esterification and nitration. Overall, this compound represents a unique combination of functional groups that may impart specific chemical behaviors and potential applications in various fields.
Formula:C16H15NO6
InChI:InChI=1S/C16H15NO6/c1-21-14-9-13(17(19)20)12(16(18)22-2)8-15(14)23-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3
InChI key:SHQBNKDRVJNGDX-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C(=C1)[N+](=O)[O-])C(=O)OC)OCC2=CC=CC=C2
Found 4 products.