CAS 16423-19-1: rel-(4R,4aR,8aS)-Octahydro-4,8a-dimethyl-4a(2H)-naphthalenol
Description:Rel-(4R,4aR,8aS)-Octahydro-4,8a-dimethyl-4a(2H)-naphthalenol, with CAS number 16423-19-1, is a bicyclic organic compound characterized by its complex polycyclic structure. It features a saturated naphthalene derivative with two methyl groups at the 4 and 8a positions, contributing to its unique stereochemistry. The compound is a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in the fragrance industry due to its pleasant odor profile, which resembles that of natural terpenes. The presence of hydroxyl (-OH) functional groups indicates that it may exhibit moderate polarity, influencing its solubility in various solvents. Additionally, the stereochemical configuration suggests that it may have specific interactions with biological systems, making it of interest in pharmacological studies. Overall, this compound exemplifies the complexity and diversity of organic molecules, with implications in both industrial and research settings.
Formula:C12H22O
InChI:InChI=1/C12H22O/c1-10-6-5-8-11(2)7-3-4-9-12(10,11)13/h10,13H,3-9H2,1-2H3/t10-,11+,12-/s2
InChI key:InChIKey=JLPUXFOGCDVKGO-XMXUMIDENA-N
SMILES:OC12CCCCC2(C)CCCC1C
- Synonyms:
- (4R,4aR,8aS)-4,8a-dimethyldecalin-4a-ol
- 4a(2H)-Naphthalenol, octahydro-4,8a-dimethyl-, (4R,4aR,8aS)-rel-
- 4a(2H)-Naphthalenol, octahydro-4,8a-dimethyl-, (4α,4aα,8aβ)-
- 4aα(2H)-Naphthol, octahydro-4α,8aβ-dimethyl-, (±)-
- <span class="text-smallcaps">DL</span>-Geosmin
- Ccris 6592
- dl-Geosmin
- rel-(4R,4aR,8aS)-Octahydro-4,8a-dimethyl-4a(2H)-naphthalenol
