CAS 1642844-75-4

3-(1,1-Dimethylethyl) 8-(phenylmethyl) 3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate

Description:

3-(1,1-Dimethylethyl) 8-(phenylmethyl) 3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate is a chemical compound characterized by its bicyclic structure, which includes a diazabicyclo framework. This compound features two carboxylate groups, contributing to its potential as a versatile building block in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) and the phenylmethyl group enhances its steric properties and may influence its reactivity and solubility in various solvents. The diazabicyclo structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic certain biological structures. Additionally, the compound's unique functional groups may allow for further derivatization, making it a candidate for various chemical reactions. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods, as they are not universally defined and can vary based on purity and environmental conditions.

Formula: C₁₉H₂₆N₂O₄

InChI: InChI=1S/C19H26N2O4/c1-19(2,3)25-17(22)20-11-15-9-10-16(12-20)21(15)18(23)24-13-14-7-5-4-6-8-14/h4-8,15-16H,9-13H2,1-3H3

InChI key: InChIKey=LCCROIKPQVESOH-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2C3CN(C(OC(C)(C)C)=O)CC2CC3

Synonyms:

• 3,8-Diazabicyclo[3.2.1]octane-3,8-dicarboxylic acid, 3-(1,1-dimethylethyl) 8-(phenylmethyl) ester
• 3-(1,1-Dimethylethyl) 8-(phenylmethyl) 3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate