CAS 164297-25-0: (S)-(p-toluenesulfinyl)ferrocene
Description:(S)-(p-Toluenesulfinyl)ferrocene is a chiral organosulfur compound that features a ferrocene backbone, which consists of two cyclopentadienyl rings sandwiching a central iron atom. The presence of the p-toluenesulfinyl group introduces a sulfinyl functional group, contributing to its unique chemical properties and reactivity. This compound is characterized by its ability to participate in asymmetric synthesis, making it valuable in the field of organic chemistry, particularly in the development of chiral catalysts. The sulfinyl group enhances the compound's polarity and solubility in various organic solvents, facilitating its use in diverse chemical reactions. Additionally, the chirality of the compound allows for the potential formation of enantiomerically enriched products, which is crucial in pharmaceuticals and fine chemicals. Its stability and reactivity can be influenced by the electronic and steric effects of the substituents on the ferrocene moiety. Overall, (S)-(p-toluenesulfinyl)ferrocene is an important compound in synthetic organic chemistry, particularly in the context of chiral synthesis and catalysis.
Formula:C17H16FeOS
InChI:InChI=1/C12H11OS.C5H5.Fe/c1-10-6-8-12(9-7-10)14(13)11-4-2-3-5-11;1-2-4-5-3-1;/h2-9H,1H3;1-5H;/t14-;;/m1../s1/rC17H16FeOS/c1-13-9-11-15(12-10-13)20(19)17-8-4-7-16(17)18-14-5-2-3-6-14/h2-12,14,16H,1H3/t16?,20-/m0/s1
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | (S)-(p-Toluenesulfinyl)ferrocene REF: 3B-T2546CAS: 164297-25-0 | >97.0%(T)(HPLC) | 226.00 € | Tue 08 Apr 25 |
 | (S)-(+)-(p-Toluenesulfinyl)ferrocene, min. 98% REF: 08-26-3706CAS: 164297-25-0 | min. 98% | 104.00 €~386.00 € | Thu 10 Apr 25 |
 | Ferrocene, [(S)-(4-methylphenyl)sulfinyl]- REF: IN-DA001URECAS: 164297-25-0 | 97.0% | To inquire | Tue 15 Apr 25 |
 | (S)-(p-Toluenesulfinyl)ferrocene REF: 3D-FT61265CAS: 164297-25-0 | Min. 95% | - - - | Discontinued product |
(S)-(p-Toluenesulfinyl)ferrocene
Ref: 3B-T2546
| 1g | 226.00 € |
(S)-(+)-(p-Toluenesulfinyl)ferrocene, min. 98%
Ref: 08-26-3706
| 100mg | 104.00 € | ||
| 500mg | 386.00 € |
![Ferrocene, [(S)-(4-methylphenyl)sulfinyl]-](https://static.cymitquimica.com/products/IN/thumb/DA001URE.jpg)
Ferrocene, [(S)-(4-methylphenyl)sulfinyl]-
Ref: IN-DA001URE
| Undefined size | To inquire |
(S)-(p-Toluenesulfinyl)ferrocene
Ref: 3D-FT61265
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
