
CAS 164322-83-2
:Cascaroside F
Description:
Cascaroside F, with the CAS number 164322-83-2, is a chemical compound primarily derived from the bark of the Rhamnus purshiana tree, commonly known as cascara sagrada. It belongs to a class of compounds known as glycosides, which are characterized by the presence of a sugar moiety linked to a non-sugar component. Cascaroside F is known for its laxative properties, often utilized in herbal medicine for its ability to stimulate bowel movements. The compound exhibits a complex structure, typically featuring a phenolic backbone, which contributes to its biological activity. In addition to its laxative effects, cascaroside F may possess antioxidant properties, although further research is needed to fully understand its pharmacological profile. As with many herbal compounds, the safety and efficacy of cascaroside F can vary based on dosage and individual health conditions, necessitating caution in its use. Overall, cascaroside F represents a significant example of natural products utilized in traditional and modern herbal therapies.
Formula:C27H32O14
InChI:InChI=1S/C27H32O14/c1-8-2-10-16(26-24(37)22(35)19(32)14(6-28)39-26)11-4-9(30)5-13(18(11)21(34)17(10)12(31)3-8)40-27-25(38)23(36)20(33)15(7-29)41-27/h2-5,14-16,19-20,22-33,35-38H,6-7H2,1H3
InChI key:InChIKey=VICGNLNFFZAFLT-UHFFFAOYSA-N
SMILES:O(C1=C2C(C(C=3C(C2=O)=C(O)C=C(C)C3)C4OC(CO)C(O)C(O)C4O)=CC(O)=C1)C5OC(CO)C(O)C(O)C5O
Synonyms:- 9(10H)-Anthracenone, 10-β-D-glucopyranosyl-1-(β-D-glucopyranosyloxy)-3,8-dihydroxy-6-methyl-, (S)-
- Cascaroside F
- 9(10H)-Anthracenone, 10-β-D-glucopyranosyl-1-(β-D-glucopyranosyloxy)-3,8-dihydroxy-6-methyl-, (10S)-
- (10S)-10-β-D-Glucopyranosyl-1-(β-D-glucopyranosyloxy)-3,8-dihydroxy-6-methyl-9(10H)-anthracenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-C-378006
Discontinued product
