CAS 164329-39-9

2-(2-ethoxyacetyl)-1,8-dimethyl-5H-imidazo[1,2-a]quinoxalin-4-one

Description:

2-(2-Ethoxyacetyl)-1,8-dimethyl-5H-imidazo[1,2-a]quinoxalin-4-one is a chemical compound characterized by its complex heterocyclic structure, which includes an imidazoquinoxaline framework. This compound features an ethoxyacetyl group, contributing to its solubility and reactivity. It typically exhibits moderate to high lipophilicity due to the presence of multiple methyl groups and the ethoxy moiety, which can influence its biological activity and pharmacokinetic properties. The imidazoquinoxaline core is known for its potential biological applications, including antimicrobial and anticancer activities. The compound may also display fluorescence properties, making it useful in various analytical applications. Its synthesis often involves multi-step organic reactions, and it may be sensitive to light and moisture, necessitating careful handling and storage. Overall, this compound represents a class of heterocycles that are of interest in medicinal chemistry and drug development.

Formula: C₁₆H₁₇N₃O₃

InChI: InChI=1/C16H17N3O3/c1-4-22-8-13(20)14-10(3)19-12-7-9(2)5-6-11(12)17-16(21)15(19)18-14/h5-7H,4,8H2,1-3H3,(H,17,21)

Imidazo[1,2-a]quinoxaline-2-carboxylic acid, 4,5-dihydro-1,8-dimethyl-4-oxo-, ethyl ester

CAS: 164329-39-9

Formula: C₁₅H₁₅N₃O₃

Purity: 95%

Molecular weight: 285.2979

Ref: IN-DA001UT0

Ethyl 1,8-dimethyl-4-oxo-4,5-dihydroimidazo[1,2-a]quinoxaline-2-carboxylate

CAS: 164329-39-9

Ethyl 1,8-dimethyl-4-oxo-4,5-dihydroimidazo[1,2-a]quinoxaline-2-carboxylate

Purity: 95%

Molecular weight: 285.30g/mol

Ref: 54-OR87554

Ethyl 1,8-dimethyl-4-oxo-4,5-dihydroimidazo[1,2-a]quinoxaline-2-carboxylate

CAS: 164329-39-9

Purity: 98%

Molecular weight: 285.3030090332031

Ref: 10-F789470