CAS 16433-43-5
:γ-Methylbenzenebutanoic acid
Description:
γ-Methylbenzenebutanoic acid, also known by its CAS number 16433-43-5, is an organic compound characterized by its structure, which includes a butanoic acid moiety with a methyl group and a phenyl group. This compound typically exhibits properties associated with carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the phenyl group contributes to its hydrophobic characteristics, while the carboxylic acid functional group imparts polar characteristics. This dual nature can affect its reactivity and interactions in various chemical environments. γ-Methylbenzenebutanoic acid may be utilized in organic synthesis and could serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific applications and behavior in chemical reactions would depend on the conditions and the presence of other reactants. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines due to potential hazards associated with its use.
Formula:C11H14O2
InChI:InChI=1/C11H14O2/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,12,13)
InChI key:InChIKey=UIIMQLPOAXFKFW-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(C)C1=CC=CC=C1
Synonyms:- 4-Phenylvaleric acid
- Benzenebutanoic Acid, Gamma-Methyl-
- Benzenebutanoic acid, γ-methyl-
- Valeric acid, 4-phenyl-
- γ-Methylbenzenebutanoic acid
- γ-Phenyl-n-valeric acid
- 4-Phenylpentanoic acid
- gamma-methylbenzenebutanoic acid
- 4-phenyl-1-pentanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Phenylpentanoic acid
CAS:<p>4-Phenylpentanoic acid is a chemical compound that is found in nature. It is used as an additive to enhance the properties of styrene, which is a colorless liquid with a sweet odor and it can be combustible. 4-Phenylpentanoic acid has been shown to inhibit the degradation of styrene by carbon tetrachloride, but its mechanism of action is not yet known. This substance has also been shown to be selective for alkali metals such as potassium and sodium, while exhibiting no selectivity for other metal ions such as magnesium or iron. This chemical also effectively removes hydroxides from metal surfaces and reacts with aliphatic hydrocarbons to form a variety of products. The nature of 4-phenylpentanoic acid's constant is not yet known.</p>Formula:C11H14O2Purity:Min. 95%Molecular weight:178.23 g/mol
