
CAS 1643499-70-0
:2-[1-(Cyclopropylmethyl)-1H-pyrazol-4-yl]-4-pyrimidinamine
Description:
2-[1-(Cyclopropylmethyl)-1H-pyrazol-4-yl]-4-pyrimidinamine, with the CAS number 1643499-70-0, is a chemical compound characterized by its unique structural features, which include a pyrazole and a pyrimidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of the cyclopropylmethyl group may influence its pharmacokinetic properties, including metabolic stability and receptor binding affinity. Additionally, the compound's functional groups suggest potential interactions with biological targets, which could be explored for therapeutic applications. Its synthesis may involve multi-step organic reactions, and it is essential to consider safety and handling protocols due to the potential reactivity of its components. Overall, this compound represents a class of heterocyclic compounds that are often investigated for their roles in drug discovery and development.
Formula:C11H13N5
InChI:InChI=1S/C11H13N5/c12-10-3-4-13-11(15-10)9-5-14-16(7-9)6-8-1-2-8/h3-5,7-8H,1-2,6H2,(H2,12,13,15)
InChI key:InChIKey=NEPZTRUGKSYJLC-UHFFFAOYSA-N
SMILES:C(N1C=C(C=N1)C=2N=C(N)C=CN2)C3CC3
Synonyms:- 4-Pyrimidinamine, 2-[1-(cyclopropylmethyl)-1H-pyrazol-4-yl]-
- 2-[1-(Cyclopropylmethyl)-1H-pyrazol-4-yl]-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.