CAS 164353-61-1

1,7-dimethyl-1H-indole-3-carbaldehyde

Description:

1,7-Dimethyl-1H-indole-3-carbaldehyde is an organic compound characterized by its indole structure, which features a fused benzene and pyrrole ring. The presence of two methyl groups at the 1 and 7 positions of the indole ring contributes to its unique properties, while the aldehyde functional group at the 3 position introduces reactivity typical of aldehydes, such as the ability to undergo oxidation and condensation reactions. This compound is typically a yellow to brown solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents like ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic indole structure. 1,7-Dimethyl-1H-indole-3-carbaldehyde is of interest in various fields, including organic synthesis and medicinal chemistry, where it may serve as an intermediate in the synthesis of biologically active compounds. Its reactivity and structural features make it a valuable building block in the development of pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₁NO

InChI: InChI=1/C11H11NO/c1-8-4-3-5-10-9(7-13)6-12(2)11(8)10/h3-7H,1-2H3

SMILES: Cc1cccc2c(cn(C)c12)C=O

Synonyms:

• 1H-indole-3-carboxaldehyde, 1,7-dimethyl-

1,7-Dimethyl-1H-indole-3-carbaldehyde

CAS: 164353-61-1

Formula: C₁₁H₁₁NO

Purity: 97%

Molecular weight: 173.2111

Ref: IN-DA001UUG

1,7-dimethyl-1H-indole-3-carbaldehyde

CAS: 164353-61-1

1,7-dimethyl-1H-indole-3-carbaldehyde

Purity: ≥90%

Molecular weight: 173.21g/mol

Ref: 54-BUP06647

1,7-dimethyl-1H-indole-3-carbaldehyde

CAS: 164353-61-1

1,7-dimethyl-1H-indole-3-carbaldehyde (ZINC14592128) is a marine derived natural products found in Lyngbya majuscula.

Formula: C₁₁H₁₁NO

Purity: 99.83%

Color and Shape: Solid

Molecular weight: 173.21

Ref: TM-TN7136

1,7-dimethyl-1H-indole-3-carbaldehyde

CAS: 164353-61-1

Formula: C₁₁H₁₁NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.215

Ref: 10-F311672