CAS 16438-42-9
:gly-gly amide hydrochloride
Description:
Gly-gly amide hydrochloride, also known as glycylglycine amide hydrochloride, is a dipeptide derivative characterized by its simple structure, consisting of two glycine units linked by an amide bond. This compound typically appears as a white to off-white crystalline powder and is soluble in water, which facilitates its use in various biochemical applications. It is often utilized in peptide synthesis, as a building block in the production of more complex peptides, and in research settings for studying peptide interactions and properties. The hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous solutions. Gly-gly amide hydrochloride is generally considered to be non-toxic and is used in laboratory settings, but like all chemical substances, it should be handled with appropriate safety measures. Its properties, such as melting point and specific reactivity, can vary based on purity and environmental conditions.
Formula:C4H9N3O2
InChI:InChI=1/C4H9N3O2/c5-1-4(9)7-2-3(6)8/h1-2,5H2,(H2,6,8)(H,7,9)
SMILES:C(C(=NCC(=N)O)O)N
Synonyms:- H-Gly-Gly-NH2 . HCl
- Glycylglycinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Gly-Gly-NH₂ · HCl
CAS:<p>Bachem ID: 4030669.</p>Formula:C4H9N3O2·HClPurity:> 99%Color and Shape:White CrystallineMolecular weight:167.6H-Gly-Gly-NH2·HCl
CAS:Gly-Gly-NH2·HCl is a nanosized antibiotic that has been shown to have antibacterial properties. It is activated by long-chain inorganic acids, such as hydrochloric acid, and organic solvents, such as acetone. This compound has an amide group that makes it acidic. The hydrocarbon chain of this molecule may be either short or long.Formula:C4H9N3O2·HClPurity:Min. 95%Molecular weight:167.59 g/mol


