CymitQuimica logo

CAS 1643967-64-9

:

3-[(2-Chloro-5-fluoro-4-pyrimidinyl)oxy]benzenamine

Description:
3-[(2-Chloro-5-fluoro-4-pyrimidinyl)oxy]benzenamine, identified by its CAS number 1643967-64-9, is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with chlorine and fluorine atoms, linked to a phenolic group via an ether bond. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the chloro and fluoro substituents can influence its reactivity, solubility, and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may display specific physical properties such as melting point, boiling point, and solubility in various solvents, which are essential for its application in research and development. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its efficacy in various biological assays, particularly in the context of drug discovery or agrochemical applications.
Formula:C10H7ClFN3O
InChI:InChI=1S/C10H7ClFN3O/c11-10-14-5-8(12)9(15-10)16-7-3-1-2-6(13)4-7/h1-5H,13H2
InChI key:InChIKey=TXNORRSCZDPTNE-UHFFFAOYSA-N
SMILES:O(C=1C(F)=CN=C(Cl)N1)C2=CC(N)=CC=C2
Synonyms:
  • 3-[(2-Chloro-5-fluoro-4-pyrimidinyl)oxy]benzenamine
  • Benzenamine, 3-[(2-chloro-5-fluoro-4-pyrimidinyl)oxy]-
  • 3-[(2-Chloro-5-fluoropyrimidin-4-yl)oxy]aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.