CAS 1644-22-0
:(1,1,2,2,2-Pentafluoroethoxy)benzene
Description:
(1,1,2,2,2-Pentafluoroethoxy)benzene, with the CAS number 1644-22-0, is an organic compound characterized by its unique structure, which includes a benzene ring substituted with a pentafluoroethoxy group. This compound is notable for its high fluorine content, which imparts distinct properties such as increased hydrophobicity and thermal stability. The presence of multiple fluorine atoms enhances its chemical resistance and makes it less reactive compared to non-fluorinated compounds. It is typically a colorless liquid or solid at room temperature, depending on its specific formulation and purity. The compound is used in various applications, including as a solvent or intermediate in chemical synthesis, particularly in the production of fluorinated materials. Its physical properties, such as boiling point and density, are influenced by the fluorinated ethoxy group, which affects its interactions with other substances. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit unique environmental and health considerations.
Formula:C8H5F5O
InChI:InChI=1S/C8H5F5O/c9-7(10,11)8(12,13)14-6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=IPNFWPNJJRACNA-UHFFFAOYSA-N
SMILES:O(C(C(F)(F)F)(F)F)C1=CC=CC=C1
Synonyms:- (1,1,2,2,2-Pentafluoroethoxy)benzene
- Benzene, (1,1,2,2,2-pentafluoroethoxy)-
- Benzene, (pentafluoroethoxy)-
- Pentafluoroethoxybenzene
- Perfluoroethyl phenyl ether
- Phenetole, α,α,β,β,β-pentafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
