CymitQuimica logo

CAS 1644-72-0

:

1-Bromo-2-[(trifluoromethyl)thio]benzene

Description:
1-Bromo-2-[(trifluoromethyl)thio]benzene, with the CAS number 1644-72-0, is an aromatic compound characterized by the presence of a bromine atom and a trifluoromethylthio group attached to a benzene ring. This compound exhibits a molecular structure that contributes to its unique chemical properties, including its reactivity and stability. The bromine substituent enhances electrophilic aromatic substitution reactions, while the trifluoromethylthio group introduces significant electron-withdrawing characteristics, influencing the compound's overall reactivity and polarity. Typically, such compounds are used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or agrochemicals. Additionally, the presence of fluorine atoms often imparts increased lipophilicity and thermal stability. The compound is generally handled with care due to the potential toxicity associated with halogenated and sulfur-containing compounds. Its physical properties, such as boiling point and solubility, are influenced by the substituents on the benzene ring, making it an interesting subject for further study in both synthetic and applied chemistry contexts.
Formula:C7H4BrF3S
InChI:InChI=1S/C7H4BrF3S/c8-5-3-1-2-4-6(5)12-7(9,10)11/h1-4H
InChI key:InChIKey=IWRJVJJQWGZKMT-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)C1=C(Br)C=CC=C1
Synonyms:
  • (2-Bromophenyl)(Trifluoromethyl)Sulfane
  • 1-Bromo-2-(trifluoromethylsulfanyl)benzene
  • 1-Bromo-2-[(Trifluoromethyl)Sulfanyl]Benzene
  • 1-Bromo-2-[(trifluoromethyl)thio]benzene
  • 1-Isothiocyanato-4-(Trifluoromethyl)Benzene
  • 2-Bromophenyl trifluoromethyl sulphide
  • Benzene, 1-bromo-2-[(trifluoromethyl)thio]-
  • Sulfide, o-bromophenyl trifluoromethyl
  • 2-(Trifluoromethylthio)bromobenzene
Found 3 products.