CAS 1644-82-2
:2-Fluoro-6-Nitrobenzaldehyde
Description:
2-Fluoro-6-nitrobenzaldehyde is an aromatic compound characterized by the presence of both a fluorine atom and a nitro group attached to a benzaldehyde structure. Its molecular formula is C7H4FNO3, indicating that it contains seven carbon atoms, four hydrogen atoms, one fluorine atom, one nitrogen atom, and three oxygen atoms. The compound features a benzene ring with a formyl group (-CHO) at one position and a nitro group (-NO2) and a fluorine atom at the 2 and 6 positions, respectively. This substitution pattern contributes to its unique chemical reactivity and properties. 2-Fluoro-6-nitrobenzaldehyde is typically a yellow to orange solid at room temperature and is soluble in organic solvents. It is used in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the nitro and fluoro groups can influence its reactivity, making it a valuable compound in synthetic chemistry. Safety precautions should be taken when handling this substance due to its potential toxicity and reactivity.
Formula:C7H4FNO3
InChI:InChI=1/C7H4FNO3/c8-6-2-1-3-7(9(11)12)5(6)4-10/h1-4H
SMILES:c1cc(c(C=O)c(c1)N(=O)=O)F
Synonyms:- 2-Fluor-6-nitrobenzolcarbaldehyd
- Benzaldehyde, 2-fluoro-6-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzaldehyde, 2-fluoro-6-nitro-
CAS:Formula:C7H4FNO3Purity:98%Color and Shape:SolidMolecular weight:169.11002-Fluoro-6-nitrobenzaldehyde
CAS:2-Fluoro-6-nitrobenzaldehydeFormula:C7H4FNO3Purity:99%Color and Shape: light brown crystalline needlesMolecular weight:169.11g/mol2-Fluoro-6-nitrobenzaldehyde
CAS:<p>2-Fluoro-6-nitrobenzaldehyde is an electron donor that reduces a range of electron acceptors including piperazine. This compound has been shown to have antitumor effects. 2-Fluoro-6-nitrobenzaldehyde has also been shown to inhibit the growth of cancer cells in vitro and in vivo. The mechanism of action is not yet known, but it is thought that 2-fluoro-6-nitrobenzaldehyde may be a potential chemotherapeutic agent for pancreatic cancer therapy.</p>Formula:C7H4FNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:169.11 g/mol2-Fluoro-6-nitrobenzaldehyde
CAS:Formula:C7H4FNO3Purity:98%Color and Shape:SolidMolecular weight:169.111




