CAS 1644164-62-4
:Poly[(5,6-difluoro-2,1,3-benzothiadiazole-4,7-diyl)[3,3′′′-bis(2-octyldodecyl)[2,2′:5′,2′′:5′′,2′′′-quaterthiophene]-5,5′′′-diyl]]
Description:
Poly[(5,6-difluoro-2,1,3-benzothiadiazole-4,7-diyl)[3,3′′′-bis(2-octyldodecyl)[2,2′:5′,2′′:5′′,2′′′-quaterthiophene]-5,5′′′-diyl]] is a conjugated polymer known for its application in organic electronics, particularly in organic photovoltaics and field-effect transistors. This polymer features a backbone composed of alternating electron-rich and electron-deficient units, which enhances its charge transport properties. The presence of difluorobenzothiadiazole units contributes to its strong electron-accepting characteristics, while the quaterthiophene segments provide good hole mobility. The long alkyl side chains, specifically octyldodecyl groups, improve the solubility of the polymer in organic solvents, facilitating processing techniques such as spin-coating or inkjet printing. Additionally, this polymer exhibits good thermal stability and can be tuned for specific optical and electronic properties by modifying its molecular structure. Its unique combination of properties makes it a promising candidate for use in advanced optoelectronic devices.
Formula:(C62H88F2N2S5)n
SMILES:C(C(CCCCCCCCCC)CCCCCCCC)C1=C(SC(=C1)C=2C=3C(C(*)=C(F)C2F)=NSN3)C=4SC(=CC4)C=5SC(=CC5)C6=C(CC(CCCCCCCCCC)CCCCCCCC)C=C(*)S6
Synonyms:- Pbt4t
- Poly[(5,6-difluoro-2,1,3-benzothiadiazole-4,7-diyl)[3,3′′′-bis(2-octyldodecyl)[2,2′:5′,2′′:5′′,2′′′-quaterthiophene]-5,5′′′-diyl]]
- PCE 11
- PffBT 4T2OD
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pffbt4T-2od
CAS:<p>Pffbt4T-2od is a low-energy compound that exhibits patterning, transport properties, and efficiencies. Pffbt4T-2od has been shown to be a model system for the study of organic molecules with alternating electron donor and acceptor groups. Functional groups on the molecule can be activated by an electrochemical reaction, which leads to the formation of morphologies. The molecule also has high values in the hydrocarbon solvent, which are associated with its ability to dissolve other substances.</p>Formula:(C62H88F2N2S5)nPurity:Min. 95%PffBT4T-2OD (PCE11)
CAS:<p>Fisher Scientific - PffBT4T-2OD (PCE11), Thermo Scientific Chemicals - 1644164-62-4</p>Formula:(C62H88N2S5F2)nColor and Shape:Flake or threadlike, Black

