CymitQuimica logo

CAS 1644602-68-5

:

1-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-1H-pyrazol-4-amine

Description:
1-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-1H-pyrazol-4-amine is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a pyridine moiety. The presence of a chloro group and a trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound is typically classified as an organic heterocyclic compound, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the pyrazole and pyridine rings may impart specific reactivity and binding characteristics, making it of interest in drug discovery and development. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioactivity. As with many such compounds, its synthesis and characterization would involve standard organic chemistry techniques, and its safety and handling would require adherence to appropriate chemical safety guidelines due to the presence of halogenated groups.
Formula:C10H8ClF3N4
InChI:InChI=1S/C10H8ClF3N4/c11-8-1-6(10(12,13)14)2-16-9(8)5-18-4-7(15)3-17-18/h1-4H,5,15H2
InChI key:InChIKey=PRADFNJNLJEPON-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=C(C(F)(F)F)C=N1)N2C=C(N)C=N2
Synonyms:
  • 1H-Pyrazol-4-amine, 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-
  • 1-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-1H-pyrazol-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.