CAS 16448-54-7

Ferric nitrilotriacetate

Description:

Ferric nitrilotriacetate, with the CAS number 16448-54-7, is a coordination compound formed from iron(III) and nitrilotriacetic acid (NTA). It typically appears as a reddish-brown solid and is soluble in water, which makes it useful in various applications, including as a chelating agent in analytical chemistry and biochemistry. The compound features a central iron ion coordinated to three acetate groups and one nitrogen atom from the nitrilotriacetate ligand, resulting in a stable octahedral geometry. Ferric nitrilotriacetate is known for its ability to form complexes with various metal ions, enhancing their solubility and bioavailability. It is also utilized in agriculture as a micronutrient fertilizer, promoting plant growth by providing essential iron. Additionally, it has applications in the field of medicine, particularly in studies related to iron metabolism and as a potential therapeutic agent. However, handling this compound requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures during use.

Formula: C₆H₆FeNO₆

InChI: InChI=1S/C6H9NO6.Fe/c8-4(9)1-7(2-5(10)11)3-6(12)13;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);/q;+3/p-3

InChI key: InChIKey=FXDLIMJMHVKXAR-UHFFFAOYSA-K

SMILES: O=C1[O-][Fe+3]23[N](CC(=O)[O-]2)(CC(=O)[O-]3)C1

Synonyms:

• Acetic acid, nitrilotri-, iron complex
• (T-4)-[N,N-Bis[(carboxy-κO)methyl]glycinato(3-)-κN,κO]iron
• Iron, (nitrilotriacetato)-
• Iron, [N,N-bis(carboxymethyl)glycinato(3-)-N,O,O′,O′′]-, (T-4)-
• Iron, [N,N-bis[(carboxy-κO)methyl]glycinato(3-)-κN,κO]-, (T-4)-

Ferric nitrilotriacetate

CAS: 16448-54-7

Ferric nitrilotriacetate (Fe-NTA), an iron complex of nitriloacetic acid, is widely used to provoke oxidative stress (OS)-linked degenerative disorders.

Formula: C₆H₆FeNO₆

Color and Shape: Solid

Molecular weight: 243.96

Ref: TM-T78655