
CAS 16448-54-7
:Ferric nitrilotriacetate
Description:
Ferric nitrilotriacetate, with the CAS number 16448-54-7, is a coordination compound formed from iron(III) and nitrilotriacetic acid (NTA). It typically appears as a reddish-brown solid and is soluble in water, which makes it useful in various applications, including as a chelating agent in analytical chemistry and biochemistry. The compound features a central iron ion coordinated to three acetate groups and one nitrogen atom from the nitrilotriacetate ligand, resulting in a stable octahedral geometry. Ferric nitrilotriacetate is known for its ability to form complexes with various metal ions, enhancing their solubility and bioavailability. It is also utilized in agriculture as a micronutrient fertilizer, promoting plant growth by providing essential iron. Additionally, it has applications in the field of medicine, particularly in studies related to iron metabolism and as a potential therapeutic agent. However, handling this compound requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures during use.
Formula:C6H6FeNO6
InChI:InChI=1S/C6H9NO6.Fe/c8-4(9)1-7(2-5(10)11)3-6(12)13;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);/q;+3/p-3
InChI key:InChIKey=FXDLIMJMHVKXAR-UHFFFAOYSA-K
SMILES:O=C1[O-][Fe+3]23[N](CC(=O)[O-]2)(CC(=O)[O-]3)C1
Synonyms:- Acetic acid, nitrilotri-, iron complex
- (T-4)-[N,N-Bis[(carboxy-κO)methyl]glycinato(3-)-κN,κO]iron
- Iron, (nitrilotriacetato)-
- Iron, [N,N-bis(carboxymethyl)glycinato(3-)-N,O,O′,O′′]-, (T-4)-
- Iron, [N,N-bis[(carboxy-κO)methyl]glycinato(3-)-κN,κO]-, (T-4)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ferric nitrilotriacetate
CAS:Ferric nitrilotriacetate (Fe-NTA), an iron complex of nitriloacetic acid, is widely used to provoke oxidative stress (OS)-linked degenerative disorders.Formula:C6H6FeNO6Color and Shape:SolidMolecular weight:243.96
