CAS 1645-09-6
:2-methyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine
Description:
2-Methyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine, also known by its CAS number 1645-09-6, is an organic compound characterized by its amine functional group and a branched alkyl structure. This compound features a propan-2-amine backbone, which is substituted with a methyl group and a phenyl ring that carries a trifluoromethyl group at the para position. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with specific receptor interactions. Additionally, the trifluoromethyl group is known to impart unique electronic properties, which can be advantageous in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with amines and fluorinated compounds.
Formula:C11H14F3N
InChI:InChI=1/C11H14F3N/c1-10(2,15)7-8-4-3-5-9(6-8)11(12,13)14/h3-6H,7,15H2,1-2H3
SMILES:CC(C)(Cc1cccc(c1)C(F)(F)F)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.