
CAS 1645-75-6
:1,1,1,3,3,3-Hexafluoro-2-propanimine
Description:
1,1,1,3,3,3-Hexafluoro-2-propanimine, with the CAS number 1645-75-6, is a fluorinated organic compound characterized by its unique structure, which includes a propanamine backbone substituted with six fluorine atoms. This compound is notable for its high degree of fluorination, which imparts distinct physical and chemical properties, such as increased stability and lower reactivity compared to non-fluorinated analogs. It typically exists as a colorless liquid or gas at room temperature and exhibits low volatility. The presence of fluorine atoms enhances its lipophilicity and can influence its solubility in various solvents. Additionally, hexafluoro compounds are often utilized in specialized applications, including as intermediates in the synthesis of pharmaceuticals and agrochemicals, as well as in materials science due to their unique thermal and chemical resistance. Safety considerations are paramount when handling such fluorinated compounds, as they may pose environmental and health risks. Proper storage and handling protocols are essential to mitigate any potential hazards associated with their use.
Formula:C3HF6N
InChI:InChI=1S/C3HF6N/c4-2(5,6)1(10)3(7,8)9/h10H
InChI key:InChIKey=VVRCKMPEMSAMST-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(F)(F)F)=N
Synonyms:- 2,2,2-Trifluoro-1-(trifluoromethyl)ethylidenimine
- 2-Propanimine, 1,1,1,3,3,3-hexafluoro-
- Ethylidenimine, 2,2,2-trifluoro-1-(trifluoromethyl)-
- Hexafluoroacetone imine
- 1,1,1,3,3,3-Hexafluoro-2-propanimine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.