CAS 164513-38-6
:5-Bromo-2-hydroxy-4-picoline
Description:
5-Bromo-2-hydroxy-4-picoline, with the CAS number 164513-38-6, is an organic compound that belongs to the class of pyridine derivatives. It features a bromine atom and a hydroxyl group attached to the pyridine ring, which contributes to its unique chemical properties. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents due to the presence of the hydroxyl group. The bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the hydroxyl group can impart hydrogen bonding capabilities, affecting its interactions with other molecules. 5-Bromo-2-hydroxy-4-picoline may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific reactivity and applications would depend on the functional groups present and the overall molecular structure, making it a compound of interest in both research and industrial contexts.
Formula:C6H6BrNO
InChI:InChI=1/C6H6BrNO/c1-4-2-6(9)8-3-5(4)7/h2-3H,1H3,(H,8,9)
SMILES:Cc1cc(ncc1Br)O
Synonyms:- 5-Bromo-2-hydroxy-4-methylpyridine
- 5-bromo-4-methylpyridin-2(1H)-one
- 2-Hydroxy-4-methyl-5-bromopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-hydroxy-4-methylpyridine, 97%
CAS:<p>It is used for medicine. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand</p>Formula:C6H6BrNOPurity:97%Molecular weight:188.025-Bromo-2-hydroxy-4-methylpyridine
CAS:Formula:C6H6BrNOPurity:95%Color and Shape:SolidMolecular weight:188.02195-Bromo-2-hydroxy-4-methylpyridine
CAS:Formula:C6H6BrNOPurity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:188.025-Bromo-2-hydroxy-4-methylpyridine
CAS:5-Bromo-2-hydroxy-4-methylpyridineFormula:C6H6BrNOPurity:98%Color and Shape: beige solidMolecular weight:188.02g/mol5-Bromo-2-hydroxy-4-methylpyridine
CAS:Formula:C6H6BrNOPurity:95%Color and Shape:Solid, Yellow powderMolecular weight:188.024




