CAS 164520-75-6

(5E)-5-[4-(2-methylpropoxy)benzylidene]-2-sulfanyl-1,3-thiazol-4(5H)-one

Description:

The chemical substance known as (5E)-5-[4-(2-methylpropoxy)benzylidene]-2-sulfanyl-1,3-thiazol-4(5H)-one, with the CAS number 164520-75-6, is a thiazole derivative characterized by its unique structural features, including a thiazolone ring and a substituted benzylidene moiety. This compound typically exhibits properties associated with thiazoles, such as potential biological activity, including antimicrobial and antifungal effects, due to the presence of the sulfur atom in the thiazole ring. The presence of the 2-methylpropoxy group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the compound's configuration, indicated by the (5E) designation, suggests a specific geometric arrangement that could affect its reactivity and interaction with biological targets. Overall, this substance may be of interest in medicinal chemistry and pharmacology, warranting further investigation into its potential applications and mechanisms of action.

Formula: C₁₄H₁₅NO₂S₂

InChI: InChI=1/C14H15NO2S2/c1-9(2)8-17-11-5-3-10(4-6-11)7-12-13(16)15-14(18)19-12/h3-7,9H,8H2,1-2H3,(H,15,16,18)/b12-7+

Synonyms:

• 4(5H)-thiazolone, 2-mercapto-5-[[4-(2-methylpropoxy)phenyl]methylene]-, (5E)-

(5E)-5-(4-Isobutoxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one

CAS: 164520-75-6

Formula: C₁₄H₁₅NO₂S₂

Molecular weight: 293.4044

Ref: IN-DA00ABAV

(5E)-5-(4-isobutoxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one

CAS: 164520-75-6

Formula: C₁₄H₁₅NO₂S₂

Purity: 95.0%

Molecular weight: 293.4

Ref: 10-F307833