CAS 164520-99-4

4-(Cyclopropylmethoxy)benzaldehyde

Description:

4-(Cyclopropylmethoxy)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group attached to a cyclopropylmethoxy substituent. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic nature. The presence of the cyclopropyl group contributes to its unique steric and electronic properties, which can influence its reactivity and interactions in chemical reactions. As a benzaldehyde derivative, it may participate in various organic synthesis reactions, including nucleophilic additions and condensation reactions. Additionally, its structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where the specific arrangement of functional groups can enhance biological activity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₂O₂

InChI: InChI=1S/C11H12O2/c12-7-9-3-5-11(6-4-9)13-8-10-1-2-10/h3-7,10H,1-2,8H2

InChI key: InChIKey=PVQVSKYXCMWDFN-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(C=O)C=C1)C2CC2

Synonyms:

• 4-(Cyclopropylmethoxy)benzaldehyde
• 4-Cyclopropylmethyloxybenzaldehyde
• Benzaldehyde, 4-(cyclopropylmethoxy)-

4-(Cyclopropylmethoxy)benzaldehyde

CAS: 164520-99-4

Formula: C₁₁H₁₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 176.2118

Ref: IN-DA00AT7A

4-(Cyclopropylmethoxy)benzaldehyde

CAS: 164520-99-4

4-(Cyclopropylmethoxy)benzaldehyde

Purity: 97%

Molecular weight: 176.21g/mol

Ref: 54-OR96514

4-(Cyclopropylmethoxy)benzaldehyde

CAS: 164520-99-4

Formula: C₁₁H₁₂O₂

Purity: 97%

Color and Shape: Liquid, Clear

Molecular weight: 176.215

Ref: 10-F094272

4-(Cyclopropylmethoxy)benzaldehyde

CAS: 164520-99-4

4-(Cyclopropylmethoxy)benzaldehyde is a flavonoid that has been shown to be able to inhibit the activity of monoamine oxidase and monoamine oxidases. It also has a selectivity index of 38, which means it is more selective for inhibiting the enzyme MAO-A than MAO-B. 4-(Cyclopropylmethoxy)benzaldehyde is a dietary flavonoid that has been shown to have a variety of neurological benefits, including anti-inflammatory and anti-depressant effects.

Formula: C₁₁H₁₂O₂

Purity: Min. 95%

Molecular weight: 176.21 g/mol

Ref: 3D-PGA52099