CAS 16455-98-4

Ethanedioic acid, antimony(3+) salt (1:?)

Description:

Ethanedioic acid, antimony(3+) salt, also known as antimony oxalate, is an inorganic compound characterized by its formation from ethanedioic acid (oxalic acid) and antimony in the +3 oxidation state. This compound typically appears as a white crystalline solid and is soluble in water, which can facilitate its use in various chemical applications. Antimony(3+) salts are known for their potential use in catalysis and as intermediates in organic synthesis. The presence of oxalate ions can impart specific properties, such as chelation with metal ions, which may enhance the compound's reactivity and stability. Additionally, antimony compounds are often studied for their biological effects and potential toxicity, necessitating careful handling and consideration in laboratory settings. Overall, the characteristics of ethanedioic acid, antimony(3+) salt make it a compound of interest in both industrial and research contexts, particularly in the fields of materials science and coordination chemistry.

Formula: C₂H₂O₄·xSb

InChI: InChI=1S/C2H2O4.Sb/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);

InChI key: InChIKey=DSXCPKFPLVABHA-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)=O.[Sb]

Synonyms:

• Ethanedioic acid, antimony salt
• Antimony oxalate
• Ethanedioic acid, antimony(3+) salt (1:?)