CymitQuimica logo

CAS 164575-82-0

:

S-[2-(4-Azidosalicylamido)ethylthio]-2-thiopyridine

Description:
S-[2-(4-Azidosalicylamido)ethylthio]-2-thiopyridine is a chemical compound characterized by its unique structural features, which include a thiopyridine core and an azidosalicylamido substituent. The presence of the azide group (-N3) suggests potential for click chemistry applications, particularly in bioconjugation and labeling due to its reactivity. The thiopyridine moiety contributes to its potential as a ligand in coordination chemistry, while the ethylthio group enhances its solubility and reactivity. This compound may exhibit interesting biological activities, possibly due to the interactions of the azide and thiopyridine functionalities with biological targets. Its synthesis typically involves multi-step organic reactions, and it may be utilized in various fields, including medicinal chemistry and materials science. Safety precautions should be observed when handling this compound, particularly due to the presence of the azide group, which can be sensitive and potentially explosive under certain conditions. Overall, S-[2-(4-Azidosalicylamido)ethylthio]-2-thiopyridine represents a versatile building block for further chemical exploration and application.
Formula:C14H13N5O2S2
InChI:InChI=1/C14H13N5O2S2/c15-19-18-10-4-5-11(12(20)9-10)14(21)17-7-8-22-23-13-3-1-2-6-16-13/h1-6,9,20H,7-8H2,(H,17,21)
SMILES:c1ccnc(c1)SSCCN=C(c1ccc(cc1O)N=[N+]=[NH-])O
Synonyms:
  • 4-azido-2-hydroxy-N-[2-(pyridin-2-yldisulfanyl)ethyl]benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.