CAS 1646-32-8

1-(5-CHLOROBENZO[B]FURAN-2-YL)ETHAN-1-ONE

Description:

1-(5-Chlorobenzo[b]furan-2-yl)ethan-1-one, with the CAS number 1646-32-8, is an organic compound characterized by its unique structure that includes a benzo[b]furan moiety substituted with a chlorine atom and an ethanone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The chlorine substituent can influence its electronic properties, making it more reactive in certain chemical reactions. It may also exhibit biological activity, which is common for compounds containing heterocycles and halogens. The compound is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. Its applications could span various fields, including pharmaceuticals and materials science, where such structural motifs are often explored for their functional properties. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₇ClO₂

InChI: InChI=1/C10H7ClO2/c1-6(12)10-5-7-4-8(11)2-3-9(7)13-10/h2-5H,1H3

SMILES: CC(=O)c1cc2cc(ccc2o1)Cl

Synonyms:

• 1-(5-Chloro-1-benzofuran-2-yl)ethanone
• Ethanone, 1-(5-Chloro-2-Benzofuranyl)-
• 1-(5-chlorobenzo[b]furan-2-yl)ethan-1-one

Ethanone, 1-(5-chloro-2-benzofuranyl)-

CAS: 1646-32-8

Formula: C₁₀H₇ClO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 194.6144

Ref: IN-DA001UZ9

1-(5-Chloro-1-benzofuran-2-yl)ethanone

CAS: 1646-32-8

1-(5-Chloro-1-benzofuran-2-yl)ethanone

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 194.61g/mol

Ref: 54-OR110910

1-(5-Chlorobenzofuran-2-yl)ethanone

CAS: 1646-32-8

Formula: C₁₀H₇ClO₂

Purity: 98%

Molecular weight: 194.61

Ref: 10-F436638