CAS 16461-99-7

1H-Pyrazol-3-amine, 4-bromo-, hydrobromide (1:1)

Description:

1H-Pyrazol-3-amine, 4-bromo-, hydrobromide (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. As a hydrobromide salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents. This compound is of interest in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anti-inflammatory properties. The hydrobromide form indicates that it can release hydrobromic acid in solution, which may influence its behavior in biological systems. Additionally, the compound's molecular structure allows for various functional group modifications, making it a versatile intermediate in organic synthesis. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₃H₄BrN₃·BrH

InChI: InChI=1S/C3H4BrN3.BrH/c4-2-1-6-7-3(2)5;/h1H,(H3,5,6,7);1H

InChI key: InChIKey=XUZSMHRCPZGCOX-UHFFFAOYSA-N

SMILES: BrC=1C(N)=NNC1.Br

Synonyms:

• Pyrazole, 3-amino-4-bromo-, monohydrobromide
• 1H-Pyrazol-3-amine, 4-bromo-, hydrobromide (1:1)

4-Bromo-1H-pyrazol-3-amine hydrobromide

CAS: 16461-99-7

4-Bromo-1H-pyrazol-3-amine hydrobromide

Formula: C₃H₄BrN₃·BrH

Purity: ≥95%

Color and Shape: light brown to beige solid

Molecular weight: 242.90g/mol

Ref: 54-OR451440