
CAS 1646152-51-3
:4-Oxazolemethanamine, N-(4-oxazolylmethyl)-, hydrochloride (1:1)
Description:
4-Oxazolemethanamine, N-(4-oxazolylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxazole ring structure, which contributes to its heterocyclic properties. This compound features an amine functional group, indicating potential basicity and reactivity with acids, as evidenced by its hydrochloride salt form. The presence of the oxazole moiety suggests that it may exhibit biological activity, potentially interacting with various biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound's molecular structure may influence its stability, solubility, and pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the specific arrangement of atoms and functional groups can affect its reactivity and interactions with other substances, which is crucial for its potential applications in drug development or as a research chemical. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C8H9N3O2·ClH
InChI:InChI=1S/C8H9N3O2.ClH/c1(7-3-12-5-10-7)9-2-8-4-13-6-11-8;/h3-6,9H,1-2H2;1H
InChI key:InChIKey=RUAQNZBUGHEETD-UHFFFAOYSA-N
SMILES:C(NCC1=COC=N1)C2=COC=N2.Cl
Synonyms:- 4-Oxazolemethanamine, N-(4-oxazolylmethyl)-, hydrochloride (1:1)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
